1H-Benzimidazole, 5-bromo-2-chloro-

1H-Benzimidazole, 5-bromo-2-chloro- - Names and Identifiers

Name	6-bromo-2-chloro-1H-benzimidazole
Synonyms	683240-76-8 T56 BM DNJ CG GE 5-Bromo-2-chlorobenzimidazole 6-bromo-2-chloro-1H-benzimidazole 5-Bromo-2-chloro-1H-benzimidazole 5-BROMO-2-CHLORO-1H-BENZIMIDAZOLE 6-Bromo-2-chloro-1H-benzoimidazole 1H-Benzimidazole, 5-bromo-2-chloro- 1H-Benzimidazole, 6-bromo-2-chloro- 5-bromo-2-chloro-1H-1,3-benzodiazole 5-Bromo-2-chloro-1H-1,3-benzimidazole 5-BroMo-2-chloro-1H-benzo[d]iMidazole
CAS	683240-76-8
InChI	InChI=1/C7H4BrClN2/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H,10,11)

1H-Benzimidazole, 5-bromo-2-chloro- - Physico-chemical Properties

Molecular Formula	C7H4BrClN2
Molar Mass	231.48
Density	1.878
Melting Point	212-213°
Boling Point	387.3±34.0 °C(Predicted)
Flash Point	188.044°C
Vapor Presure	0mmHg at 25°C
pKa	8.56±0.10(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.73

1H-Benzimidazole, 5-bromo-2-chloro- - Risk and Safety

Hazard Class

IRRITANT

1H-Benzimidazole, 5-bromo-2-chloro- - Introduction

It is an organic compound with the following properties:

1. Appearance: colorless crystalline solid.
2. molecular formula: C7H4BrClN2.
3. Molecular weight: 231.48g/mol.

according to the name of the compound, we can understand that its structure contains a benzimidazole ring, in which the position 2 is replaced by a chlorine atom and the position 6 is replaced by a bromine atom.

This compound has certain applications in chemical laboratories:

1. as an organic synthesis intermediate, commonly used in the synthesis of other organic compounds.
2. In drug research, it can be used to synthesize biologically active molecules.

The main preparation methods are as follows:

1. The organic acid salt is generated by the reaction of chlorobenzimidazole and bromoacetic acid, and then the target product is obtained in the form of acid hydrolysis and salt removal.
2. the target product is generated by the reaction of benzimidazole and bromochloromethane.

It should be noted that for any chemical compound, it is necessary to operate under suitable experimental conditions and follow relevant safety procedures and laboratory safety guidelines.

For your safety information, here are some common safety precautions:

1. This compound may be irritating and corrosive and requires the proper use of personal protective equipment (such as gloves, goggles, etc.).
2. Avoid inhalation, ingestion or contact with skin and eyes during operation.
3. Avoid fire, high temperature and oxidant during storage and handling.
4. Pay attention to the correct method of waste disposal and follow the relevant laws and regulations.
5. Keep away from children and pets when using or storing, and avoid eating or improper use.

Last Update：2024-04-09 21:54:55